C25H25NO5 — CID 164618141
[(3aS,5S,9R,9aS,9bS)-9-hydroxy-6,9-dimethyl-3-methylidene-2-oxo-4,5,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-5-yl] quinoline-6-carboxylate (PubChem CID 164618141) has the molecular formula C25H25NO5 and a molecular weight of 419.48 g/mol. Its IUPAC name is [(3aS,5S,9R,9aS,9bS)-9-hydroxy-6,9-dimethyl-3-methylidene-2-oxo-4,5,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-5-yl] quinoline-6-carboxylate.
| Compound Name | [(3aS,5S,9R,9aS,9bS)-9-hydroxy-6,9-dimethyl-3-methylidene-2-oxo-4,5,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-5-yl] quinoline-6-carboxylate |
|---|---|
| PubChem CID | 164618141 |
| Molecular Formula | C25H25NO5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | [(3aS,5S,9R,9aS,9bS)-9-hydroxy-6,9-dimethyl-3-methylidene-2-oxo-4,5,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-5-yl] quinoline-6-carboxylate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1C[C@H](OC(=O)c1ccc3ncccc3c1)C(C)=C1CC[C@@](C)(O)[C@@H]12 |
| InChI | InChI=1S/C25H25NO5/c1-13-17-8-9-25(3,29)21(17)22-18(14(2)23(27)31-22)12-20(13)30-24(28)16-6-7-19-15(11-16)5-4-10-26-19/h4-7,10-11,18,20-22,29H,2,8-9,12H2,1,3H3/t18-,20-,21-,22-,25+/m0/s1 |
| InChIKey | TVTLVGXLEYUBQB-BRVYXMLXSA-N |
| XLogP | 3.74 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|