C14H15IN2 — CID 164618158
4,5,7-trimethylpyrrolo[1,2-a]quinoxalin-5-ium iodide (PubChem CID 164618158) has the molecular formula C14H15IN2 and a molecular weight of 338.19 g/mol. Its IUPAC name is 4,5,7-trimethylpyrrolo[1,2-a]quinoxalin-5-ium iodide.
| Compound Name | 4,5,7-trimethylpyrrolo[1,2-a]quinoxalin-5-ium iodide |
|---|---|
| PubChem CID | 164618158 |
| Molecular Formula | C14H15IN2 |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 4,5,7-trimethylpyrrolo[1,2-a]quinoxalin-5-ium iodide |
| SMILES | Cc1ccc2c(c1)[n+](C)c(C)c1cccn12.[I-] |
| InChI | InChI=1S/C14H15N2.HI/c1-10-6-7-13-14(9-10)15(3)11(2)12-5-4-8-16(12)13;/h4-9H,1-3H3;1H/q+1;/p-1 |
| InChIKey | BNEOJHSKVRSJGX-UHFFFAOYSA-M |
| XLogP | -0.46 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|