C19H24N2O2 — CID 164618200
2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methylphthalazine-1,4-dione (PubChem CID 164618200) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methylphthalazine-1,4-dione.
| Compound Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methylphthalazine-1,4-dione |
|---|---|
| PubChem CID | 164618200 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methylphthalazine-1,4-dione |
| SMILES | CC(C)=CCC/C(C)=C/Cn1c(=O)c2ccccc2c(=O)n1C |
| InChI | InChI=1S/C19H24N2O2/c1-14(2)8-7-9-15(3)12-13-21-19(23)17-11-6-5-10-16(17)18(22)20(21)4/h5-6,8,10-12H,7,9,13H2,1-4H3/b15-12+ |
| InChIKey | ABCNGMUSUBSCSG-NTCAYCPXSA-N |
| XLogP | 3.39 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|