C25H32Cl2N6O2 — CID 164618204
4-(cyclohexylamino)-2-[(2,5-dichlorophenyl)methylamino]-N-[3-(2-oxopyrrolidin-1-yl)propyl]pyrimidine-5-carboxamide (PubChem CID 164618204) has the molecular formula C25H32Cl2N6O2 and a molecular weight of 519.48 g/mol. Its IUPAC name is 4-(cyclohexylamino)-2-[(2,5-dichlorophenyl)methylamino]-N-[3-(2-oxopyrrolidin-1-yl)propyl]pyrimidine-5-carboxamide.
| Compound Name | 4-(cyclohexylamino)-2-[(2,5-dichlorophenyl)methylamino]-N-[3-(2-oxopyrrolidin-1-yl)propyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 164618204 |
| Molecular Formula | C25H32Cl2N6O2 |
| Molecular Weight | 519.48 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | 4-(cyclohexylamino)-2-[(2,5-dichlorophenyl)methylamino]-N-[3-(2-oxopyrrolidin-1-yl)propyl]pyrimidine-5-carboxamide |
| SMILES | O=C(NCCCN1CCCC1=O)c1cnc(NCc2cc(Cl)ccc2Cl)nc1NC1CCCCC1 |
| InChI | InChI=1S/C25H32Cl2N6O2/c26-18-9-10-21(27)17(14-18)15-29-25-30-16-20(23(32-25)31-19-6-2-1-3-7-19)24(35)28-11-5-13-33-12-4-8-22(33)34/h9-10,14,16,19H,1-8,11-13,15H2,(H,28,35)(H2,29,30,31,32) |
| InChIKey | FVWICVDPLXWCKJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|