C33H29F3N8O7 — CID 164618298
4-[3-[4-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxymethyl]triazol-1-yl]butyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 164618298) has the molecular formula C33H29F3N8O7 and a molecular weight of 706.64 g/mol. Its IUPAC name is 4-[3-[4-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxymethyl]triazol-1-yl]butyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-[4-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxymethyl]triazol-1-yl]butyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 164618298 |
| Molecular Formula | C33H29F3N8O7 |
| Molecular Weight | 706.64 g/mol |
| Exact Mass | 706.21 |
| IUPAC Name | 4-[3-[4-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxymethyl]triazol-1-yl]butyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC1(C)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=O)N1CCCCn1cc(COc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)nn1 |
| InChI | InChI=1S/C33H29F3N8O7/c1-32(2)30(49)43(20-9-8-18(15-37)22(14-20)33(34,35)36)31(50)42(32)13-4-3-12-41-16-19(39-40-41)17-51-24-7-5-6-21-26(24)29(48)44(28(21)47)23-10-11-25(45)38-27(23)46/h5-9,14,16,23H,3-4,10-13,17H2,1-2H3,(H,38,45,46) |
| InChIKey | RYHTUFBADYIIAZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 187.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.64 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|