C21H16N6O — CID 164618301
3-[4-[4-(3-hydroxyphenyl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrazol-1-yl]propanenitrile (PubChem CID 164618301) has the molecular formula C21H16N6O and a molecular weight of 368.40 g/mol. Its IUPAC name is 3-[4-[4-(3-hydroxyphenyl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrazol-1-yl]propanenitrile.
| Compound Name | 3-[4-[4-(3-hydroxyphenyl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrazol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 164618301 |
| Molecular Formula | C21H16N6O |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 3-[4-[4-(3-hydroxyphenyl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrazol-1-yl]propanenitrile |
| SMILES | N#CCCn1cc(-n2c(-c3cccc(O)c3)cc3cnc4[nH]ccc4c32)cn1 |
| InChI | InChI=1S/C21H16N6O/c22-6-2-8-26-13-16(12-25-26)27-19(14-3-1-4-17(28)9-14)10-15-11-24-21-18(20(15)27)5-7-23-21/h1,3-5,7,9-13,28H,2,8H2,(H,23,24) |
| InChIKey | KOWONJTXTATJHK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |