C29H21N7O2S — CID 164618317
4-[[5-methyl-7-[(5-phenyl-1H-pyrazol-3-yl)amino]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]sulfanylmethyl]benzo[h]chromen-2-one (PubChem CID 164618317) has the molecular formula C29H21N7O2S and a molecular weight of 531.60 g/mol. Its IUPAC name is 4-[[5-methyl-7-[(5-phenyl-1H-pyrazol-3-yl)amino]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]sulfanylmethyl]benzo[h]chromen-2-one.
| Compound Name | 4-[[5-methyl-7-[(5-phenyl-1H-pyrazol-3-yl)amino]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]sulfanylmethyl]benzo[h]chromen-2-one |
|---|---|
| PubChem CID | 164618317 |
| Molecular Formula | C29H21N7O2S |
| Molecular Weight | 531.60 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | 4-[[5-methyl-7-[(5-phenyl-1H-pyrazol-3-yl)amino]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]sulfanylmethyl]benzo[h]chromen-2-one |
| SMILES | Cc1cc(Nc2cc(-c3ccccc3)[nH]n2)n2nc(SCc3cc(=O)oc4c3ccc3ccccc34)nc2n1 |
| InChI | InChI=1S/C29H21N7O2S/c1-17-13-25(31-24-15-23(33-34-24)19-8-3-2-4-9-19)36-28(30-17)32-29(35-36)39-16-20-14-26(37)38-27-21-10-6-5-7-18(21)11-12-22(20)27/h2-15H,16H2,1H3,(H2,31,33,34) |
| InChIKey | YQMXLIOZOPDNDP-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 114.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.60 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|