C26H23N3O6 — CID 164618346
5,7-dihydroxy-2-(4-hydroxyphenyl)-8-[[4-(pyridine-2-carbonyl)piperazin-1-yl]methyl]chromen-4-one (PubChem CID 164618346) has the molecular formula C26H23N3O6 and a molecular weight of 473.49 g/mol. Its IUPAC name is 5,7-dihydroxy-2-(4-hydroxyphenyl)-8-[[4-(pyridine-2-carbonyl)piperazin-1-yl]methyl]chromen-4-one.
| Compound Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-8-[[4-(pyridine-2-carbonyl)piperazin-1-yl]methyl]chromen-4-one |
|---|---|
| PubChem CID | 164618346 |
| Molecular Formula | C26H23N3O6 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-8-[[4-(pyridine-2-carbonyl)piperazin-1-yl]methyl]chromen-4-one |
| SMILES | O=C(c1ccccn1)N1CCN(Cc2c(O)cc(O)c3c(=O)cc(-c4ccc(O)cc4)oc23)CC1 |
| InChI | InChI=1S/C26H23N3O6/c30-17-6-4-16(5-7-17)23-14-22(33)24-21(32)13-20(31)18(25(24)35-23)15-28-9-11-29(12-10-28)26(34)19-3-1-2-8-27-19/h1-8,13-14,30-32H,9-12,15H2 |
| InChIKey | YBFDJRDCTPQNDP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 127.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|