About 7-(3,4-dimethoxy-5-methylselanylphenyl)-2-(1-methylindol-5-yl)pyrazolo[1,5-a]pyrazine
7-(3,4-dimethoxy-5-methylselanylphenyl)-2-(1-methylindol-5-yl)pyrazolo[1,5-a]pyrazine (PubChem CID 164618474) has the molecular formula C24H22N4O2Se
and a molecular weight of 477.43 g/mol. Its IUPAC name is 7-(3,4-dimethoxy-5-methylselanylphenyl)-2-(1-methylindol-5-yl)pyrazolo[1,5-a]pyrazine.
Molecular Properties
| Compound Name | 7-(3,4-dimethoxy-5-methylselanylphenyl)-2-(1-methylindol-5-yl)pyrazolo[1,5-a]pyrazine |
| PubChem CID | 164618474 |
| Molecular Formula | C24H22N4O2Se |
| Molecular Weight | 477.43 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 7-(3,4-dimethoxy-5-methylselanylphenyl)-2-(1-methylindol-5-yl)pyrazolo[1,5-a]pyrazine |
| SMILES | COc1cc(-c2cncc3cc(-c4ccc5c(ccn5C)c4)nn23)cc([Se]C)c1OC |
| InChI | InChI=1S/C24H22N4O2Se/c1-27-8-7-16-9-15(5-6-20(16)27)19-12-18-13-25-14-21(28(18)26-19)17-10-22(29-2)24(30-3)23(11-17)31-4/h5-14H,1-4H3 |
| InChIKey | VZCSKHJNDISYIO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 53.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 477.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 7-(3,4-dimethoxy-5-methylselanylphenyl)-2-(1-methylindol-5-yl)pyrazolo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3,4-dimethoxy-5-methylselanylphenyl)-2-(1-methylindol-5-yl)pyrazolo[1,5-a]pyrazine?
The IUPAC name of 7-(3,4-dimethoxy-5-methylselanylphenyl)-2-(1-methylindol-5-yl)pyrazolo[1,5-a]pyrazine (CID 164618474) is 7-(3,4-dimethoxy-5-methylselanylphenyl)-2-(1-methylindol-5-yl)pyrazolo[1,5-a]pyrazine.
What is the SMILES notation for 7-(3,4-dimethoxy-5-methylselanylphenyl)-2-(1-methylindol-5-yl)pyrazolo[1,5-a]pyrazine?
The canonical SMILES for 7-(3,4-dimethoxy-5-methylselanylphenyl)-2-(1-methylindol-5-yl)pyrazolo[1,5-a]pyrazine is COc1cc(-c2cncc3cc(-c4ccc5c(ccn5C)c4)nn23)cc([Se]C)c1OC.
What is the InChIKey of 7-(3,4-dimethoxy-5-methylselanylphenyl)-2-(1-methylindol-5-yl)pyrazolo[1,5-a]pyrazine?
The InChIKey is VZCSKHJNDISYIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N4O2Se/c1-27-8-7-16-9-15(5-6-20(16)27)19-12-18-13-25-14-21(28(18)26-19)17-10-22(29-2)24(30-3)23(11-17)31-4/h5-14H,1-4H3.
What are the key properties of 7-(3,4-dimethoxy-5-methylselanylphenyl)-2-(1-methylindol-5-yl)pyrazolo[1,5-a]pyrazine?
7-(3,4-dimethoxy-5-methylselanylphenyl)-2-(1-methylindol-5-yl)pyrazolo[1,5-a]pyrazine has a molecular weight of 477.43 g/mol, XLogP of 3.95, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3,4-dimethoxy-5-methylselanylphenyl)-2-(1-methylindol-5-yl)pyrazolo[1,5-a]pyrazine is sourced from PubChem (CID 164618474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).