C11H20BNO4 — CID 164618604
(1R,3S,4R,5R)-4-(3-boronopropyl)-4-methyl-2-azabicyclo[3.2.0]heptane-3-carboxylic acid (PubChem CID 164618604) has the molecular formula C11H20BNO4 and a molecular weight of 241.10 g/mol. Its IUPAC name is (1R,3S,4R,5R)-4-(3-boronopropyl)-4-methyl-2-azabicyclo[3.2.0]heptane-3-carboxylic acid.
| Compound Name | (1R,3S,4R,5R)-4-(3-boronopropyl)-4-methyl-2-azabicyclo[3.2.0]heptane-3-carboxylic acid |
|---|---|
| PubChem CID | 164618604 |
| Molecular Formula | C11H20BNO4 |
| Molecular Weight | 241.10 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | (1R,3S,4R,5R)-4-(3-boronopropyl)-4-methyl-2-azabicyclo[3.2.0]heptane-3-carboxylic acid |
| SMILES | C[C@]1(CCCB(O)O)[C@@H](C(=O)O)N[C@@H]2CC[C@@H]21 |
| InChI | InChI=1S/C11H20BNO4/c1-11(5-2-6-12(16)17)7-3-4-8(7)13-9(11)10(14)15/h7-9,13,16-17H,2-6H2,1H3,(H,14,15)/t7-,8+,9+,11+/m0/s1 |
| InChIKey | RTIXQPQJAUDDDI-YSSBGUOXSA-N |
| XLogP | 0.08 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.10 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|