C26H32N2O7 — CID 164618635
8-(2,2-dimethoxyethoxy)-2-[4-(3,5-dimethylpiperazin-1-yl)phenyl]-5-hydroxy-7-methoxychromen-4-one (PubChem CID 164618635) has the molecular formula C26H32N2O7 and a molecular weight of 484.55 g/mol. Its IUPAC name is 8-(2,2-dimethoxyethoxy)-2-[4-(3,5-dimethylpiperazin-1-yl)phenyl]-5-hydroxy-7-methoxychromen-4-one.
| Compound Name | 8-(2,2-dimethoxyethoxy)-2-[4-(3,5-dimethylpiperazin-1-yl)phenyl]-5-hydroxy-7-methoxychromen-4-one |
|---|---|
| PubChem CID | 164618635 |
| Molecular Formula | C26H32N2O7 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | 8-(2,2-dimethoxyethoxy)-2-[4-(3,5-dimethylpiperazin-1-yl)phenyl]-5-hydroxy-7-methoxychromen-4-one |
| SMILES | COc1cc(O)c2c(=O)cc(-c3ccc(N4CC(C)NC(C)C4)cc3)oc2c1OCC(OC)OC |
| InChI | InChI=1S/C26H32N2O7/c1-15-12-28(13-16(2)27-15)18-8-6-17(7-9-18)21-10-19(29)24-20(30)11-22(31-3)25(26(24)35-21)34-14-23(32-4)33-5/h6-11,15-16,23,27,30H,12-14H2,1-5H3 |
| InChIKey | GHIKBBJLVSUFGF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 102.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|