C28H40O3 — CID 164618769
(E,2R,5S)-2-[(5R,9R,10S,13R,17R)-10,13-dimethyl-3-oxo-1,2,4,5,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-5,6-dimethylhept-3-enoic acid (PubChem CID 164618769) has the molecular formula C28H40O3 and a molecular weight of 424.63 g/mol. Its IUPAC name is (E,2R,5S)-2-[(5R,9R,10S,13R,17R)-10,13-dimethyl-3-oxo-1,2,4,5,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-5,6-dimethylhept-3-enoic acid.
| Compound Name | (E,2R,5S)-2-[(5R,9R,10S,13R,17R)-10,13-dimethyl-3-oxo-1,2,4,5,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-5,6-dimethylhept-3-enoic acid |
|---|---|
| PubChem CID | 164618769 |
| Molecular Formula | C28H40O3 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | (E,2R,5S)-2-[(5R,9R,10S,13R,17R)-10,13-dimethyl-3-oxo-1,2,4,5,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-5,6-dimethylhept-3-enoic acid |
| SMILES | CC(C)[C@H](C)/C=C/[C@@H](C(=O)O)[C@H]1CCC2=C3C=C[C@H]4CC(=O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C28H40O3/c1-17(2)18(3)6-8-22(26(30)31)24-11-10-23-21-9-7-19-16-20(29)12-14-27(19,4)25(21)13-15-28(23,24)5/h6-9,17-19,22,24-25H,10-16H2,1-5H3,(H,30,31)/b8-6+/t18-,19+,22-,24-,25+,27+,28+/m1/s1 |
| InChIKey | XEZHHAXMXMJRKB-AHJIANKASA-N |
| XLogP | 6.60 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|