C23H25F2N5O5 — CID 164618827
11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-(2-morpholin-4-ylethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-triene-4,12-dione (PubChem CID 164618827) has the molecular formula C23H25F2N5O5 and a molecular weight of 489.48 g/mol. Its IUPAC name is 11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-(2-morpholin-4-ylethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-triene-4,12-dione.
| Compound Name | 11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-(2-morpholin-4-ylethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-triene-4,12-dione |
|---|---|
| PubChem CID | 164618827 |
| Molecular Formula | C23H25F2N5O5 |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-(2-morpholin-4-ylethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-triene-4,12-dione |
| SMILES | COc1cc(OC)c(F)c(N2Cc3cnc4c(c3N(CCN3CCOCC3)C2=O)CC(=O)N4)c1F |
| InChI | InChI=1S/C23H25F2N5O5/c1-33-15-10-16(34-2)19(25)21(18(15)24)30-12-13-11-26-22-14(9-17(31)27-22)20(13)29(23(30)32)4-3-28-5-7-35-8-6-28/h10-11H,3-9,12H2,1-2H3,(H,26,27,31) |
| InChIKey | SEPMAUHVHUSELH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 96.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |