About 3-[5-(1,5-dimethylindol-3-yl)-1H-pyrrol-2-yl]-1,5-dimethylindole
3-[5-(1,5-dimethylindol-3-yl)-1H-pyrrol-2-yl]-1,5-dimethylindole (PubChem CID 164619156) has the molecular formula C24H23N3
and a molecular weight of 353.47 g/mol. Its IUPAC name is 3-[5-(1,5-dimethylindol-3-yl)-1H-pyrrol-2-yl]-1,5-dimethylindole.
Molecular Properties
| Compound Name | 3-[5-(1,5-dimethylindol-3-yl)-1H-pyrrol-2-yl]-1,5-dimethylindole |
| PubChem CID | 164619156 |
| Molecular Formula | C24H23N3 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 3-[5-(1,5-dimethylindol-3-yl)-1H-pyrrol-2-yl]-1,5-dimethylindole |
| SMILES | Cc1ccc2c(c1)c(-c1ccc(-c3cn(C)c4ccc(C)cc34)[nH]1)cn2C |
| InChI | InChI=1S/C24H23N3/c1-15-5-9-23-17(11-15)19(13-26(23)3)21-7-8-22(25-21)20-14-27(4)24-10-6-16(2)12-18(20)24/h5-14,25H,1-4H3 |
| InChIKey | DSPFGCMMWAPMJF-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 25.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[5-(1,5-dimethylindol-3-yl)-1H-pyrrol-2-yl]-1,5-dimethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(1,5-dimethylindol-3-yl)-1H-pyrrol-2-yl]-1,5-dimethylindole?
The IUPAC name of 3-[5-(1,5-dimethylindol-3-yl)-1H-pyrrol-2-yl]-1,5-dimethylindole (CID 164619156) is 3-[5-(1,5-dimethylindol-3-yl)-1H-pyrrol-2-yl]-1,5-dimethylindole.
What is the SMILES notation for 3-[5-(1,5-dimethylindol-3-yl)-1H-pyrrol-2-yl]-1,5-dimethylindole?
The canonical SMILES for 3-[5-(1,5-dimethylindol-3-yl)-1H-pyrrol-2-yl]-1,5-dimethylindole is Cc1ccc2c(c1)c(-c1ccc(-c3cn(C)c4ccc(C)cc34)[nH]1)cn2C.
What is the InChIKey of 3-[5-(1,5-dimethylindol-3-yl)-1H-pyrrol-2-yl]-1,5-dimethylindole?
The InChIKey is DSPFGCMMWAPMJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23N3/c1-15-5-9-23-17(11-15)19(13-26(23)3)21-7-8-22(25-21)20-14-27(4)24-10-6-16(2)12-18(20)24/h5-14,25H,1-4H3.
What are the key properties of 3-[5-(1,5-dimethylindol-3-yl)-1H-pyrrol-2-yl]-1,5-dimethylindole?
3-[5-(1,5-dimethylindol-3-yl)-1H-pyrrol-2-yl]-1,5-dimethylindole has a molecular weight of 353.47 g/mol, XLogP of 5.95, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(1,5-dimethylindol-3-yl)-1H-pyrrol-2-yl]-1,5-dimethylindole is sourced from PubChem (CID 164619156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).