C27H30F3N3O3 — CID 164619203
(2R)-2-[(1R,3R)-1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propanoic acid (PubChem CID 164619203) has the molecular formula C27H30F3N3O3 and a molecular weight of 501.55 g/mol. Its IUPAC name is (2R)-2-[(1R,3R)-1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propanoic acid.
| Compound Name | (2R)-2-[(1R,3R)-1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 164619203 |
| Molecular Formula | C27H30F3N3O3 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | (2R)-2-[(1R,3R)-1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propanoic acid |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(OCCN3CC(CF)C3)cc2F)N1[C@H](C)C(=O)O |
| InChI | InChI=1S/C27H30F3N3O3/c1-15-9-20-19-5-3-4-6-23(19)31-25(20)26(33(15)16(2)27(34)35)24-21(29)10-18(11-22(24)30)36-8-7-32-13-17(12-28)14-32/h3-6,10-11,15-17,26,31H,7-9,12-14H2,1-2H3,(H,34,35)/t15-,16-,26-/m1/s1 |
| InChIKey | AWRMPCIASLTTTI-KVUUWBKYSA-N |
| XLogP | 4.54 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|