C30H34N6O3 — CID 164619315
(2S)-3-amino-2-(5-hydroxy-2-methyl-1H-indol-3-yl)-N-[(1S)-1-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]pentyl]propanamide (PubChem CID 164619315) has the molecular formula C30H34N6O3 and a molecular weight of 526.64 g/mol. Its IUPAC name is (2S)-3-amino-2-(5-hydroxy-2-methyl-1H-indol-3-yl)-N-[(1S)-1-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]pentyl]propanamide.
| Compound Name | (2S)-3-amino-2-(5-hydroxy-2-methyl-1H-indol-3-yl)-N-[(1S)-1-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]pentyl]propanamide |
|---|---|
| PubChem CID | 164619315 |
| Molecular Formula | C30H34N6O3 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | (2S)-3-amino-2-(5-hydroxy-2-methyl-1H-indol-3-yl)-N-[(1S)-1-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]pentyl]propanamide |
| SMILES | CCCC[C@H](NC(=O)[C@H](CN)c1c(C)[nH]c2ccc(O)cc12)c1ncc(-c2cc3ccccc3nc2OC)[nH]1 |
| InChI | InChI=1S/C30H34N6O3/c1-4-5-9-25(35-29(38)22(15-31)27-17(2)33-24-12-11-19(37)14-20(24)27)28-32-16-26(34-28)21-13-18-8-6-7-10-23(18)36-30(21)39-3/h6-8,10-14,16,22,25,33,37H,4-5,9,15,31H2,1-3H3,(H,32,34)(H,35,38)/t22-,25+/m1/s1 |
| InChIKey | JTWPJSNVYHZOPL-RDGATRHJSA-N |
| XLogP | 5.22 |
| TPSA | 141.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|