C35H22N4O6S — CID 164619361
2,3-bis(1H-indole-3-carbonyl)-7-(4-methylphenyl)sulfonyl-1H-pyrrolo[3,2-f]indole-4,8-dione (PubChem CID 164619361) has the molecular formula C35H22N4O6S and a molecular weight of 626.65 g/mol. Its IUPAC name is 2,3-bis(1H-indole-3-carbonyl)-7-(4-methylphenyl)sulfonyl-1H-pyrrolo[3,2-f]indole-4,8-dione.
| Compound Name | 2,3-bis(1H-indole-3-carbonyl)-7-(4-methylphenyl)sulfonyl-1H-pyrrolo[3,2-f]indole-4,8-dione |
|---|---|
| PubChem CID | 164619361 |
| Molecular Formula | C35H22N4O6S |
| Molecular Weight | 626.65 g/mol |
| Exact Mass | 626.13 |
| IUPAC Name | 2,3-bis(1H-indole-3-carbonyl)-7-(4-methylphenyl)sulfonyl-1H-pyrrolo[3,2-f]indole-4,8-dione |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c2C(=O)c2[nH]c(C(=O)c4c[nH]c5ccccc45)c(C(=O)c4c[nH]c5ccccc45)c2C3=O)cc1 |
| InChI | InChI=1S/C35H22N4O6S/c1-18-10-12-19(13-11-18)46(44,45)39-15-14-22-31(39)35(43)30-28(32(22)40)27(33(41)23-16-36-25-8-4-2-6-20(23)25)29(38-30)34(42)24-17-37-26-9-5-3-7-21(24)26/h2-17,36-38H,1H3 |
| InChIKey | COOVTBAFFWJKAL-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 154.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.65 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|