C20H26O3 — CID 164619410
4-[(2R,5aS,9aS)-6,6,9a-trimethyl-4-oxo-1,2,3,5,5a,7,8,9-octahydrocyclopenta[a]naphthalen-2-yl]-2H-furan-5-one (PubChem CID 164619410) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is 4-[(2R,5aS,9aS)-6,6,9a-trimethyl-4-oxo-1,2,3,5,5a,7,8,9-octahydrocyclopenta[a]naphthalen-2-yl]-2H-furan-5-one.
| Compound Name | 4-[(2R,5aS,9aS)-6,6,9a-trimethyl-4-oxo-1,2,3,5,5a,7,8,9-octahydrocyclopenta[a]naphthalen-2-yl]-2H-furan-5-one |
|---|---|
| PubChem CID | 164619410 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 4-[(2R,5aS,9aS)-6,6,9a-trimethyl-4-oxo-1,2,3,5,5a,7,8,9-octahydrocyclopenta[a]naphthalen-2-yl]-2H-furan-5-one |
| SMILES | CC1(C)CCC[C@]2(C)C3=C(C[C@H](C4=CCOC4=O)C3)C(=O)C[C@@H]12 |
| InChI | InChI=1S/C20H26O3/c1-19(2)6-4-7-20(3)15-10-12(13-5-8-23-18(13)22)9-14(15)16(21)11-17(19)20/h5,12,17H,4,6-11H2,1-3H3/t12-,17-,20+/m0/s1 |
| InChIKey | HOFGDYNGISNEHI-CYFODOTGSA-N |
| XLogP | 3.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |