3-[2-(2,6-dimethylphenyl)-1H-indol-5-yl]propanoic acid

C19H19NO2 — CID 164619456

IUPAC3-[2-(2,6-dimethylphenyl)-1H-indol-5-yl]propanoic acid
SMILESCc1cccc(C)c1-c1cc2cc(CCC(=O)O)ccc2[nH]1
InChIInChI=1S/C19H19NO2/c1-12-4-3-5-13(2)19(12)17-11-15-10-14(7-9-18(21)22)6-8-16(15)20-17/h3-6,8,10-11,20H,7,9H2,1-2H3,(H,21,22)
InChIKeyUIEVDFIZTUJBOQ-UHFFFAOYSA-N
MW293.37 g/mol
LogP4.47
Rot. Bonds4

About 3-[2-(2,6-dimethylphenyl)-1H-indol-5-yl]propanoic acid

3-[2-(2,6-dimethylphenyl)-1H-indol-5-yl]propanoic acid (PubChem CID 164619456) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 3-[2-(2,6-dimethylphenyl)-1H-indol-5-yl]propanoic acid.

Molecular Properties

Compound Name3-[2-(2,6-dimethylphenyl)-1H-indol-5-yl]propanoic acid
PubChem CID164619456
Molecular FormulaC19H19NO2
Molecular Weight293.37 g/mol
Exact Mass293.14
IUPAC Name3-[2-(2,6-dimethylphenyl)-1H-indol-5-yl]propanoic acid
SMILESCc1cccc(C)c1-c1cc2cc(CCC(=O)O)ccc2[nH]1
InChIInChI=1S/C19H19NO2/c1-12-4-3-5-13(2)19(12)17-11-15-10-14(7-9-18(21)22)6-8-16(15)20-17/h3-6,8,10-11,20H,7,9H2,1-2H3,(H,21,22)
InChIKeyUIEVDFIZTUJBOQ-UHFFFAOYSA-N
XLogP4.47
TPSA53.09 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500293.37
LogP ≤ 54.47
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Analyze 3-[2-(2,6-dimethylphenyl)-1H-indol-5-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-(2,6-dimethylphenyl)-1H-indol-5-yl]propanoic acid?
The IUPAC name of 3-[2-(2,6-dimethylphenyl)-1H-indol-5-yl]propanoic acid (CID 164619456) is 3-[2-(2,6-dimethylphenyl)-1H-indol-5-yl]propanoic acid.
What is the SMILES notation for 3-[2-(2,6-dimethylphenyl)-1H-indol-5-yl]propanoic acid?
The canonical SMILES for 3-[2-(2,6-dimethylphenyl)-1H-indol-5-yl]propanoic acid is Cc1cccc(C)c1-c1cc2cc(CCC(=O)O)ccc2[nH]1.
What is the InChIKey of 3-[2-(2,6-dimethylphenyl)-1H-indol-5-yl]propanoic acid?
The InChIKey is UIEVDFIZTUJBOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO2/c1-12-4-3-5-13(2)19(12)17-11-15-10-14(7-9-18(21)22)6-8-16(15)20-17/h3-6,8,10-11,20H,7,9H2,1-2H3,(H,21,22).
What are the key properties of 3-[2-(2,6-dimethylphenyl)-1H-indol-5-yl]propanoic acid?
3-[2-(2,6-dimethylphenyl)-1H-indol-5-yl]propanoic acid has a molecular weight of 293.37 g/mol, XLogP of 4.47, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2,6-dimethylphenyl)-1H-indol-5-yl]propanoic acid is sourced from PubChem (CID 164619456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).