C19H19NO2 — CID 164619456
3-[2-(2,6-dimethylphenyl)-1H-indol-5-yl]propanoic acid (PubChem CID 164619456) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 3-[2-(2,6-dimethylphenyl)-1H-indol-5-yl]propanoic acid.
| Compound Name | 3-[2-(2,6-dimethylphenyl)-1H-indol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 164619456 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 3-[2-(2,6-dimethylphenyl)-1H-indol-5-yl]propanoic acid |
| SMILES | Cc1cccc(C)c1-c1cc2cc(CCC(=O)O)ccc2[nH]1 |
| InChI | InChI=1S/C19H19NO2/c1-12-4-3-5-13(2)19(12)17-11-15-10-14(7-9-18(21)22)6-8-16(15)20-17/h3-6,8,10-11,20H,7,9H2,1-2H3,(H,21,22) |
| InChIKey | UIEVDFIZTUJBOQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |