C38H40O4 — CID 164619492
4-[3-hydroxy-7,7,9-trimethyl-1-(2-phenylethyl)-6,6a,8,10a-tetrahydrobenzo[c]chromen-6-yl]-5-(2-phenylethyl)benzene-1,3-diol (PubChem CID 164619492) has the molecular formula C38H40O4 and a molecular weight of 560.73 g/mol. Its IUPAC name is 4-[3-hydroxy-7,7,9-trimethyl-1-(2-phenylethyl)-6,6a,8,10a-tetrahydrobenzo[c]chromen-6-yl]-5-(2-phenylethyl)benzene-1,3-diol.
| Compound Name | 4-[3-hydroxy-7,7,9-trimethyl-1-(2-phenylethyl)-6,6a,8,10a-tetrahydrobenzo[c]chromen-6-yl]-5-(2-phenylethyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 164619492 |
| Molecular Formula | C38H40O4 |
| Molecular Weight | 560.73 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | 4-[3-hydroxy-7,7,9-trimethyl-1-(2-phenylethyl)-6,6a,8,10a-tetrahydrobenzo[c]chromen-6-yl]-5-(2-phenylethyl)benzene-1,3-diol |
| SMILES | CC1=CC2c3c(CCc4ccccc4)cc(O)cc3OC(c3c(O)cc(O)cc3CCc3ccccc3)C2C(C)(C)C1 |
| InChI | InChI=1S/C38H40O4/c1-24-18-31-34-27(16-14-25-10-6-4-7-11-25)19-30(40)22-33(34)42-37(36(31)38(2,3)23-24)35-28(20-29(39)21-32(35)41)17-15-26-12-8-5-9-13-26/h4-13,18-22,31,36-37,39-41H,14-17,23H2,1-3H3 |
| InChIKey | PKJNQYKSGHMPCP-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.73 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|