C44H48ClN7O6 — CID 164619508
N-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-[4-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperidin-4-yl]piperazin-1-yl]benzamide (PubChem CID 164619508) has the molecular formula C44H48ClN7O6 and a molecular weight of 806.36 g/mol. Its IUPAC name is N-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-[4-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperidin-4-yl]piperazin-1-yl]benzamide.
| Compound Name | N-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-[4-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperidin-4-yl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 164619508 |
| Molecular Formula | C44H48ClN7O6 |
| Molecular Weight | 806.36 g/mol |
| Exact Mass | 805.34 |
| IUPAC Name | N-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-[4-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperidin-4-yl]piperazin-1-yl]benzamide |
| SMILES | CC1(C)C(NC(=O)c2ccc(N3CCN(C4CCN(c5ccc6c(c5)C(=O)N(C5CCC(=O)NC5=O)C6=O)CC4)CC3)cc2)C(C)(C)C1Oc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C44H48ClN7O6/c1-43(2)41(44(3,4)42(43)58-31-11-7-27(25-46)34(45)24-31)48-37(54)26-5-8-28(9-6-26)50-19-21-51(22-20-50)29-15-17-49(18-16-29)30-10-12-32-33(23-30)40(57)52(39(32)56)35-13-14-36(53)47-38(35)55/h5-12,23-24,29,35,41-42H,13-22H2,1-4H3,(H,48,54)(H,47,53,55) |
| InChIKey | GOJVIZZNCNOPSJ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 155.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.36 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|