C38H47F3N5O3+ — CID 164619687
cyclohexyl-[7-[4-[3-[(3,5-difluorophenyl)carbamoyl]-7-(dimethylamino)-4-oxo-1,8-naphthyridin-1-yl]-3-fluorophenoxy]heptyl]-dimethylazanium (PubChem CID 164619687) has the molecular formula C38H47F3N5O3+ and a molecular weight of 678.82 g/mol. Its IUPAC name is cyclohexyl-[7-[4-[3-[(3,5-difluorophenyl)carbamoyl]-7-(dimethylamino)-4-oxo-1,8-naphthyridin-1-yl]-3-fluorophenoxy]heptyl]-dimethylazanium.
| Compound Name | cyclohexyl-[7-[4-[3-[(3,5-difluorophenyl)carbamoyl]-7-(dimethylamino)-4-oxo-1,8-naphthyridin-1-yl]-3-fluorophenoxy]heptyl]-dimethylazanium |
|---|---|
| PubChem CID | 164619687 |
| Molecular Formula | C38H47F3N5O3+ |
| Molecular Weight | 678.82 g/mol |
| Exact Mass | 678.36 |
| IUPAC Name | cyclohexyl-[7-[4-[3-[(3,5-difluorophenyl)carbamoyl]-7-(dimethylamino)-4-oxo-1,8-naphthyridin-1-yl]-3-fluorophenoxy]heptyl]-dimethylazanium |
| SMILES | CN(C)c1ccc2c(=O)c(C(=O)Nc3cc(F)cc(F)c3)cn(-c3ccc(OCCCCCCC[N+](C)(C)C4CCCCC4)cc3F)c2n1 |
| InChI | InChI=1S/C38H46F3N5O3/c1-44(2)35-18-16-31-36(47)32(38(48)42-28-22-26(39)21-27(40)23-28)25-45(37(31)43-35)34-17-15-30(24-33(34)41)49-20-12-7-5-6-11-19-46(3,4)29-13-9-8-10-14-29/h15-18,21-25,29H,5-14,19-20H2,1-4H3/p+1 |
| InChIKey | YOMCZZLXEJQXOA-UHFFFAOYSA-O |
| XLogP | 7.86 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.82 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|