C28H30F8N2O4S2 — CID 164619718
N-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-1-methylsulfonylpiperidin-4-amine (PubChem CID 164619718) has the molecular formula C28H30F8N2O4S2 and a molecular weight of 674.68 g/mol. Its IUPAC name is N-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-1-methylsulfonylpiperidin-4-amine.
| Compound Name | N-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-1-methylsulfonylpiperidin-4-amine |
|---|---|
| PubChem CID | 164619718 |
| Molecular Formula | C28H30F8N2O4S2 |
| Molecular Weight | 674.68 g/mol |
| Exact Mass | 674.15 |
| IUPAC Name | N-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-1-methylsulfonylpiperidin-4-amine |
| SMILES | CS(=O)(=O)N1CCC(N[C@@H]2CC[C@@]3(S(=O)(=O)c4ccc(F)cc4)c4ccc(C(F)(C(F)(F)F)C(F)(F)F)cc4CC[C@@H]23)CC1 |
| InChI | InChI=1S/C28H30F8N2O4S2/c1-43(39,40)38-14-11-20(12-15-38)37-24-10-13-25(44(41,42)21-6-4-19(29)5-7-21)22-9-3-18(16-17(22)2-8-23(24)25)26(30,27(31,32)33)28(34,35)36/h3-7,9,16,20,23-24,37H,2,8,10-15H2,1H3/t23-,24+,25+/m0/s1 |
| InChIKey | NOVVQYRXOGCBJM-ISJGIBHGSA-N |
| XLogP | 5.52 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.68 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |