C22H20N6S — CID 164619781
5-[4-[4-(5-methylthiophen-2-yl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrazol-1-yl]pentanenitrile (PubChem CID 164619781) has the molecular formula C22H20N6S and a molecular weight of 400.51 g/mol. Its IUPAC name is 5-[4-[4-(5-methylthiophen-2-yl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrazol-1-yl]pentanenitrile.
| Compound Name | 5-[4-[4-(5-methylthiophen-2-yl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrazol-1-yl]pentanenitrile |
|---|---|
| PubChem CID | 164619781 |
| Molecular Formula | C22H20N6S |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 5-[4-[4-(5-methylthiophen-2-yl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrazol-1-yl]pentanenitrile |
| SMILES | Cc1ccc(-c2cc3cnc4[nH]ccc4c3n2-c2cnn(CCCCC#N)c2)s1 |
| InChI | InChI=1S/C22H20N6S/c1-15-5-6-20(29-15)19-11-16-12-25-22-18(7-9-24-22)21(16)28(19)17-13-26-27(14-17)10-4-2-3-8-23/h5-7,9,11-14H,2-4,10H2,1H3,(H,24,25) |
| InChIKey | UCXWXWKRSMXGGI-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 75.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|