C34H40N6O4S2 — CID 164619875
(30E)-25,36-dioxa-43,44-dithia-4,6,7,14,15,17-hexazapentacyclo[35.3.1.15,8.113,16.120,24]tetratetraconta-1(41),5,7,13,15,20(42),21,23,30,37,39-undecaene-3,18-dione (PubChem CID 164619875) has the molecular formula C34H40N6O4S2 and a molecular weight of 660.87 g/mol. Its IUPAC name is (30E)-25,36-dioxa-43,44-dithia-4,6,7,14,15,17-hexazapentacyclo[35.3.1.15,8.113,16.120,24]tetratetraconta-1(41),5,7,13,15,20(42),21,23,30,37,39-undecaene-3,18-dione.
| Compound Name | (30E)-25,36-dioxa-43,44-dithia-4,6,7,14,15,17-hexazapentacyclo[35.3.1.15,8.113,16.120,24]tetratetraconta-1(41),5,7,13,15,20(42),21,23,30,37,39-undecaene-3,18-dione |
|---|---|
| PubChem CID | 164619875 |
| Molecular Formula | C34H40N6O4S2 |
| Molecular Weight | 660.87 g/mol |
| Exact Mass | 660.26 |
| IUPAC Name | (30E)-25,36-dioxa-43,44-dithia-4,6,7,14,15,17-hexazapentacyclo[35.3.1.15,8.113,16.120,24]tetratetraconta-1(41),5,7,13,15,20(42),21,23,30,37,39-undecaene-3,18-dione |
| SMILES | O=C1Cc2cccc(c2)OCCCC/C=C/CCCCOc2cccc(c2)CC(=O)Nc2nnc(s2)CCCCc2nnc(s2)N1 |
| InChI | InChI=1S/C34H40N6O4S2/c41-29-23-25-13-11-15-27(21-25)43-19-9-5-3-1-2-4-6-10-20-44-28-16-12-14-26(22-28)24-30(42)36-34-40-38-32(46-34)18-8-7-17-31-37-39-33(35-29)45-31/h1-2,11-16,21-22H,3-10,17-20,23-24H2,(H,35,39,41)(H,36,40,42)/b2-1+ |
| InChIKey | FTYGYFKMSWMABA-OWOJBTEDSA-N |
| XLogP | 6.99 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.87 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|