About (5R)-5-[(1S,11R)-1,11-dihydroxydodecyl]oxolan-2-one
(5R)-5-[(1S,11R)-1,11-dihydroxydodecyl]oxolan-2-one (PubChem CID 164619905) has the molecular formula C16H30O4
and a molecular weight of 286.41 g/mol. Its IUPAC name is (5R)-5-[(1S,11R)-1,11-dihydroxydodecyl]oxolan-2-one.
Molecular Properties
| Compound Name | (5R)-5-[(1S,11R)-1,11-dihydroxydodecyl]oxolan-2-one |
| PubChem CID | 164619905 |
| Molecular Formula | C16H30O4 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | (5R)-5-[(1S,11R)-1,11-dihydroxydodecyl]oxolan-2-one |
| SMILES | C[C@@H](O)CCCCCCCCC[C@H](O)[C@H]1CCC(=O)O1 |
| InChI | InChI=1S/C16H30O4/c1-13(17)9-7-5-3-2-4-6-8-10-14(18)15-11-12-16(19)20-15/h13-15,17-18H,2-12H2,1H3/t13-,14+,15-/m1/s1 |
| InChIKey | RPNKWHNJSFMHIV-QLFBSQMISA-N |
| XLogP | 2.94 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-[(1S,11R)-1,11-dihydroxydodecyl]oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-[(1S,11R)-1,11-dihydroxydodecyl]oxolan-2-one?
The IUPAC name of (5R)-5-[(1S,11R)-1,11-dihydroxydodecyl]oxolan-2-one (CID 164619905) is (5R)-5-[(1S,11R)-1,11-dihydroxydodecyl]oxolan-2-one.
What is the SMILES notation for (5R)-5-[(1S,11R)-1,11-dihydroxydodecyl]oxolan-2-one?
The canonical SMILES for (5R)-5-[(1S,11R)-1,11-dihydroxydodecyl]oxolan-2-one is C[C@@H](O)CCCCCCCCC[C@H](O)[C@H]1CCC(=O)O1.
What is the InChIKey of (5R)-5-[(1S,11R)-1,11-dihydroxydodecyl]oxolan-2-one?
The InChIKey is RPNKWHNJSFMHIV-QLFBSQMISA-N. The full InChI is InChI=1S/C16H30O4/c1-13(17)9-7-5-3-2-4-6-8-10-14(18)15-11-12-16(19)20-15/h13-15,17-18H,2-12H2,1H3/t13-,14+,15-/m1/s1.
What are the key properties of (5R)-5-[(1S,11R)-1,11-dihydroxydodecyl]oxolan-2-one?
(5R)-5-[(1S,11R)-1,11-dihydroxydodecyl]oxolan-2-one has a molecular weight of 286.41 g/mol, XLogP of 2.94, 11 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-[(1S,11R)-1,11-dihydroxydodecyl]oxolan-2-one is sourced from PubChem (CID 164619905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).