C43H51N7O6 — CID 164619996
4-[4-[4-[1-[3-(1,3-dioxoisoindol-2-yl)propyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]butyl]triazol-1-yl]-N-[2-(5-methoxy-1H-indol-2-yl)ethyl]butanamide (PubChem CID 164619996) has the molecular formula C43H51N7O6 and a molecular weight of 761.92 g/mol. Its IUPAC name is 4-[4-[4-[1-[3-(1,3-dioxoisoindol-2-yl)propyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]butyl]triazol-1-yl]-N-[2-(5-methoxy-1H-indol-2-yl)ethyl]butanamide.
| Compound Name | 4-[4-[4-[1-[3-(1,3-dioxoisoindol-2-yl)propyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]butyl]triazol-1-yl]-N-[2-(5-methoxy-1H-indol-2-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 164619996 |
| Molecular Formula | C43H51N7O6 |
| Molecular Weight | 761.92 g/mol |
| Exact Mass | 761.39 |
| IUPAC Name | 4-[4-[4-[1-[3-(1,3-dioxoisoindol-2-yl)propyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]butyl]triazol-1-yl]-N-[2-(5-methoxy-1H-indol-2-yl)ethyl]butanamide |
| SMILES | COc1ccc2[nH]c(CCNC(=O)CCCn3cc(CCCCN4CCc5cc(OC)c(OC)cc5C4CCCN4C(=O)c5ccccc5C4=O)nn3)cc2c1 |
| InChI | InChI=1S/C43H51N7O6/c1-54-33-15-16-37-30(25-33)24-31(45-37)17-19-44-41(51)14-9-21-49-28-32(46-47-49)10-6-7-20-48-23-18-29-26-39(55-2)40(56-3)27-36(29)38(48)13-8-22-50-42(52)34-11-4-5-12-35(34)43(50)53/h4-5,11-12,15-16,24-28,38,45H,6-10,13-14,17-23H2,1-3H3,(H,44,51) |
| InChIKey | RPUGJNGKBHPNKQ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 143.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.92 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|