C19H15F3N6O2S2 — CID 164620032
1,1,1-trifluoro-N-[2-[4-(4-thiophen-2-yl-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)pyrazol-1-yl]ethyl]methanesulfonamide (PubChem CID 164620032) has the molecular formula C19H15F3N6O2S2 and a molecular weight of 480.50 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[2-[4-(4-thiophen-2-yl-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)pyrazol-1-yl]ethyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[2-[4-(4-thiophen-2-yl-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)pyrazol-1-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 164620032 |
| Molecular Formula | C19H15F3N6O2S2 |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 1,1,1-trifluoro-N-[2-[4-(4-thiophen-2-yl-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)pyrazol-1-yl]ethyl]methanesulfonamide |
| SMILES | O=S(=O)(NCCn1cc(-n2c(-c3cccs3)cc3cnc4[nH]ccc4c32)cn1)C(F)(F)F |
| InChI | InChI=1S/C19H15F3N6O2S2/c20-19(21,22)32(29,30)26-5-6-27-11-13(10-25-27)28-15(16-2-1-7-31-16)8-12-9-24-18-14(17(12)28)3-4-23-18/h1-4,7-11,26H,5-6H2,(H,23,24) |
| InChIKey | IODPSTHGQSKBCD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |