C21H18F3N5S — CID 164620088
4-(5-methylthiophen-2-yl)-3-[1-(4,4,4-trifluorobutyl)pyrazol-4-yl]-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene (PubChem CID 164620088) has the molecular formula C21H18F3N5S and a molecular weight of 429.47 g/mol. Its IUPAC name is 4-(5-methylthiophen-2-yl)-3-[1-(4,4,4-trifluorobutyl)pyrazol-4-yl]-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene.
| Compound Name | 4-(5-methylthiophen-2-yl)-3-[1-(4,4,4-trifluorobutyl)pyrazol-4-yl]-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
|---|---|
| PubChem CID | 164620088 |
| Molecular Formula | C21H18F3N5S |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 4-(5-methylthiophen-2-yl)-3-[1-(4,4,4-trifluorobutyl)pyrazol-4-yl]-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
| SMILES | Cc1ccc(-c2cc3cnc4[nH]ccc4c3n2-c2cnn(CCCC(F)(F)F)c2)s1 |
| InChI | InChI=1S/C21H18F3N5S/c1-13-3-4-18(30-13)17-9-14-10-26-20-16(5-7-25-20)19(14)29(17)15-11-27-28(12-15)8-2-6-21(22,23)24/h3-5,7,9-12H,2,6,8H2,1H3,(H,25,26) |
| InChIKey | AZAPSIXZKHNJTO-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |