C26H29N3O5 — CID 164620098
tert-butyl N-[(3R)-1-[(6-hydroxy-1,3-benzodioxol-5-yl)-quinolin-4-ylmethyl]pyrrolidin-3-yl]carbamate (PubChem CID 164620098) has the molecular formula C26H29N3O5 and a molecular weight of 463.53 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[(6-hydroxy-1,3-benzodioxol-5-yl)-quinolin-4-ylmethyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[(6-hydroxy-1,3-benzodioxol-5-yl)-quinolin-4-ylmethyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 164620098 |
| Molecular Formula | C26H29N3O5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | tert-butyl N-[(3R)-1-[(6-hydroxy-1,3-benzodioxol-5-yl)-quinolin-4-ylmethyl]pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCN(C(c2cc3c(cc2O)OCO3)c2ccnc3ccccc23)C1 |
| InChI | InChI=1S/C26H29N3O5/c1-26(2,3)34-25(31)28-16-9-11-29(14-16)24(18-8-10-27-20-7-5-4-6-17(18)20)19-12-22-23(13-21(19)30)33-15-32-22/h4-8,10,12-13,16,24,30H,9,11,14-15H2,1-3H3,(H,28,31)/t16-,24?/m1/s1 |
| InChIKey | KPXFMMPOTSJLPY-YAOANENCSA-N |
| XLogP | 4.36 |
| TPSA | 93.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|