C17H26O5 — CID 164620110
[(4S)-4-[(3S,3aS,4S,7aR)-4-hydroxy-3,6-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-3H-1-benzofuran-5-yl]pentyl] acetate (PubChem CID 164620110) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is [(4S)-4-[(3S,3aS,4S,7aR)-4-hydroxy-3,6-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-3H-1-benzofuran-5-yl]pentyl] acetate.
| Compound Name | [(4S)-4-[(3S,3aS,4S,7aR)-4-hydroxy-3,6-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-3H-1-benzofuran-5-yl]pentyl] acetate |
|---|---|
| PubChem CID | 164620110 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | [(4S)-4-[(3S,3aS,4S,7aR)-4-hydroxy-3,6-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-3H-1-benzofuran-5-yl]pentyl] acetate |
| SMILES | CC(=O)OCCC[C@H](C)C1=C(C)C[C@H]2OC(=O)[C@@H](C)[C@H]2[C@@H]1O |
| InChI | InChI=1S/C17H26O5/c1-9(6-5-7-21-12(4)18)14-10(2)8-13-15(16(14)19)11(3)17(20)22-13/h9,11,13,15-16,19H,5-8H2,1-4H3/t9-,11-,13+,15+,16+/m0/s1 |
| InChIKey | OSCDGRYYWBLDMQ-LVVWVTSZSA-N |
| XLogP | 2.22 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|