C20H32O2 — CID 164620153
(1S,3S,8S,13S)-3,7,7-trimethyl-13-propan-2-yl-14,16-dioxatetracyclo[11.2.1.02,11.03,8]hexadec-2(11)-ene (PubChem CID 164620153) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1S,3S,8S,13S)-3,7,7-trimethyl-13-propan-2-yl-14,16-dioxatetracyclo[11.2.1.02,11.03,8]hexadec-2(11)-ene.
| Compound Name | (1S,3S,8S,13S)-3,7,7-trimethyl-13-propan-2-yl-14,16-dioxatetracyclo[11.2.1.02,11.03,8]hexadec-2(11)-ene |
|---|---|
| PubChem CID | 164620153 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1S,3S,8S,13S)-3,7,7-trimethyl-13-propan-2-yl-14,16-dioxatetracyclo[11.2.1.02,11.03,8]hexadec-2(11)-ene |
| SMILES | CC(C)[C@@]12CC3=C([C@@H](CO1)O2)[C@@]1(C)CCCC(C)(C)[C@@H]1CC3 |
| InChI | InChI=1S/C20H32O2/c1-13(2)20-11-14-7-8-16-18(3,4)9-6-10-19(16,5)17(14)15(22-20)12-21-20/h13,15-16H,6-12H2,1-5H3/t15-,16+,19+,20+/m1/s1 |
| InChIKey | MVIHKJSSPLSTJD-LPWQTFTOSA-N |
| XLogP | 5.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|