C21H32N6OS — CID 164620704
1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-[2-(4-propan-2-ylphenyl)propyl]urea (PubChem CID 164620704) has the molecular formula C21H32N6OS and a molecular weight of 416.60 g/mol. Its IUPAC name is 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-[2-(4-propan-2-ylphenyl)propyl]urea.
| Compound Name | 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-[2-(4-propan-2-ylphenyl)propyl]urea |
|---|---|
| PubChem CID | 164620704 |
| Molecular Formula | C21H32N6OS |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-[2-(4-propan-2-ylphenyl)propyl]urea |
| SMILES | Cc1nc(N)sc1CCC/N=C(\N)NC(=O)NCC(C)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C21H32N6OS/c1-13(2)16-7-9-17(10-8-16)14(3)12-25-21(28)27-19(22)24-11-5-6-18-15(4)26-20(23)29-18/h7-10,13-14H,5-6,11-12H2,1-4H3,(H2,23,26)(H4,22,24,25,27,28) |
| InChIKey | MLGLIGBDVREXSK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|