C23H27F3N4O — CID 164620747
(3aS,6aR)-2-[dideuterio(oxan-4-yl)methyl]-N-[6-(2,3,5-trifluorophenyl)pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 164620747) has the molecular formula C23H27F3N4O and a molecular weight of 434.50 g/mol. Its IUPAC name is (3aS,6aR)-2-[dideuterio(oxan-4-yl)methyl]-N-[6-(2,3,5-trifluorophenyl)pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | (3aS,6aR)-2-[dideuterio(oxan-4-yl)methyl]-N-[6-(2,3,5-trifluorophenyl)pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 164620747 |
| Molecular Formula | C23H27F3N4O |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | (3aS,6aR)-2-[dideuterio(oxan-4-yl)methyl]-N-[6-(2,3,5-trifluorophenyl)pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | [2H]C([2H])(C1CCOCC1)N1C[C@H]2CC(Nc3ccc(-c4cc(F)cc(F)c4F)nn3)C[C@H]2C1 |
| InChI | InChI=1S/C23H27F3N4O/c24-17-9-19(23(26)20(25)10-17)21-1-2-22(29-28-21)27-18-7-15-12-30(13-16(15)8-18)11-14-3-5-31-6-4-14/h1-2,9-10,14-16,18H,3-8,11-13H2,(H,27,29)/t15-,16+,18?/i11D2 |
| InChIKey | ITSKPCHXUYILTR-ODQDRIJQSA-N |
| XLogP | 4.11 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|