About N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclopentanamine
N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclopentanamine (PubChem CID 164620837) has the molecular formula C15H27N
and a molecular weight of 221.39 g/mol. Its IUPAC name is N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclopentanamine.
Molecular Properties
| Compound Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclopentanamine |
| PubChem CID | 164620837 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclopentanamine |
| SMILES | CC(C)=CCC/C(C)=C/CNC1CCCC1 |
| InChI | InChI=1S/C15H27N/c1-13(2)7-6-8-14(3)11-12-16-15-9-4-5-10-15/h7,11,15-16H,4-6,8-10,12H2,1-3H3/b14-11+ |
| InChIKey | SMBQCSAHIJCFFW-SDNWHVSQSA-N |
| XLogP | 4.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclopentanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclopentanamine?
The IUPAC name of N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclopentanamine (CID 164620837) is N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclopentanamine.
What is the SMILES notation for N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclopentanamine?
The canonical SMILES for N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclopentanamine is CC(C)=CCC/C(C)=C/CNC1CCCC1.
What is the InChIKey of N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclopentanamine?
The InChIKey is SMBQCSAHIJCFFW-SDNWHVSQSA-N. The full InChI is InChI=1S/C15H27N/c1-13(2)7-6-8-14(3)11-12-16-15-9-4-5-10-15/h7,11,15-16H,4-6,8-10,12H2,1-3H3/b14-11+.
What are the key properties of N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclopentanamine?
N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclopentanamine has a molecular weight of 221.39 g/mol, XLogP of 4.21, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclopentanamine is sourced from PubChem (CID 164620837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).