C14H22O4 — CID 164620893
(4aS,7R,8R)-7-[(2S)-1,2-dihydroxypropan-2-yl]-8-hydroxy-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-one (PubChem CID 164620893) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is (4aS,7R,8R)-7-[(2S)-1,2-dihydroxypropan-2-yl]-8-hydroxy-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-one.
| Compound Name | (4aS,7R,8R)-7-[(2S)-1,2-dihydroxypropan-2-yl]-8-hydroxy-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-one |
|---|---|
| PubChem CID | 164620893 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (4aS,7R,8R)-7-[(2S)-1,2-dihydroxypropan-2-yl]-8-hydroxy-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-one |
| SMILES | C[C@]12CCC(=O)C=C1[C@H](O)[C@H]([C@](C)(O)CO)CC2 |
| InChI | InChI=1S/C14H22O4/c1-13-5-3-9(16)7-11(13)12(17)10(4-6-13)14(2,18)8-15/h7,10,12,15,17-18H,3-6,8H2,1-2H3/t10-,12-,13-,14-/m1/s1 |
| InChIKey | XPAODYBHHJSDQM-FMKGYKFTSA-N |
| XLogP | 0.80 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |