C18H16N6O2S2 — CID 164620923
5-(3-methoxyphenyl)-3-[[5-(3-methoxyphenyl)-1H-1,2,4-triazol-3-yl]disulfanyl]-1H-1,2,4-triazole (PubChem CID 164620923) has the molecular formula C18H16N6O2S2 and a molecular weight of 412.50 g/mol. Its IUPAC name is 5-(3-methoxyphenyl)-3-[[5-(3-methoxyphenyl)-1H-1,2,4-triazol-3-yl]disulfanyl]-1H-1,2,4-triazole.
| Compound Name | 5-(3-methoxyphenyl)-3-[[5-(3-methoxyphenyl)-1H-1,2,4-triazol-3-yl]disulfanyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 164620923 |
| Molecular Formula | C18H16N6O2S2 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 5-(3-methoxyphenyl)-3-[[5-(3-methoxyphenyl)-1H-1,2,4-triazol-3-yl]disulfanyl]-1H-1,2,4-triazole |
| SMILES | COc1cccc(-c2nc(SSc3n[nH]c(-c4cccc(OC)c4)n3)n[nH]2)c1 |
| InChI | InChI=1S/C18H16N6O2S2/c1-25-13-7-3-5-11(9-13)15-19-17(23-21-15)27-28-18-20-16(22-24-18)12-6-4-8-14(10-12)26-2/h3-10H,1-2H3,(H,19,21,23)(H,20,22,24) |
| InChIKey | HGQNMSOZDGNPKX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|