C20H28O2 — CID 164620992
(3aR,5E,9Z,12aS)-3a,6-dimethyl-2-oxo-1-propan-2-ylidene-4,7,8,11,12,12a-hexahydro-3H-cyclopenta[11]annulene-10-carbaldehyde (PubChem CID 164620992) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (3aR,5E,9Z,12aS)-3a,6-dimethyl-2-oxo-1-propan-2-ylidene-4,7,8,11,12,12a-hexahydro-3H-cyclopenta[11]annulene-10-carbaldehyde.
| Compound Name | (3aR,5E,9Z,12aS)-3a,6-dimethyl-2-oxo-1-propan-2-ylidene-4,7,8,11,12,12a-hexahydro-3H-cyclopenta[11]annulene-10-carbaldehyde |
|---|---|
| PubChem CID | 164620992 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (3aR,5E,9Z,12aS)-3a,6-dimethyl-2-oxo-1-propan-2-ylidene-4,7,8,11,12,12a-hexahydro-3H-cyclopenta[11]annulene-10-carbaldehyde |
| SMILES | CC(C)=C1C(=O)C[C@@]2(C)C/C=C(\C)CC/C=C(\C=O)CC[C@H]12 |
| InChI | InChI=1S/C20H28O2/c1-14(2)19-17-9-8-16(13-21)7-5-6-15(3)10-11-20(17,4)12-18(19)22/h7,10,13,17H,5-6,8-9,11-12H2,1-4H3/b15-10+,16-7-/t17-,20-/m1/s1 |
| InChIKey | SVDXJBCNVGUNPY-ZTHPXSDRSA-N |
| XLogP | 4.95 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|