C20H21FN2O2S — CID 164621040
5-(3-fluoro-4-methoxyphenyl)-2-[[(1S,3R)-3-isothiocyanato-2,2-dimethylcyclobutyl]oxymethyl]pyridine (PubChem CID 164621040) has the molecular formula C20H21FN2O2S and a molecular weight of 372.47 g/mol. Its IUPAC name is 5-(3-fluoro-4-methoxyphenyl)-2-[[(1S,3R)-3-isothiocyanato-2,2-dimethylcyclobutyl]oxymethyl]pyridine.
| Compound Name | 5-(3-fluoro-4-methoxyphenyl)-2-[[(1S,3R)-3-isothiocyanato-2,2-dimethylcyclobutyl]oxymethyl]pyridine |
|---|---|
| PubChem CID | 164621040 |
| Molecular Formula | C20H21FN2O2S |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 5-(3-fluoro-4-methoxyphenyl)-2-[[(1S,3R)-3-isothiocyanato-2,2-dimethylcyclobutyl]oxymethyl]pyridine |
| SMILES | COc1ccc(-c2ccc(CO[C@H]3C[C@@H](N=C=S)C3(C)C)nc2)cc1F |
| InChI | InChI=1S/C20H21FN2O2S/c1-20(2)18(23-12-26)9-19(20)25-11-15-6-4-14(10-22-15)13-5-7-17(24-3)16(21)8-13/h4-8,10,18-19H,9,11H2,1-3H3/t18-,19+/m1/s1 |
| InChIKey | ZPZJXISAYDZMIP-MOPGFXCFSA-N |
| XLogP | 4.68 |
| TPSA | 43.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|