C21H18N6S — CID 164621087
4-[4-[4-(5-methylthiophen-2-yl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrazol-1-yl]butanenitrile (PubChem CID 164621087) has the molecular formula C21H18N6S and a molecular weight of 386.48 g/mol. Its IUPAC name is 4-[4-[4-(5-methylthiophen-2-yl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrazol-1-yl]butanenitrile.
| Compound Name | 4-[4-[4-(5-methylthiophen-2-yl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrazol-1-yl]butanenitrile |
|---|---|
| PubChem CID | 164621087 |
| Molecular Formula | C21H18N6S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 4-[4-[4-(5-methylthiophen-2-yl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrazol-1-yl]butanenitrile |
| SMILES | Cc1ccc(-c2cc3cnc4[nH]ccc4c3n2-c2cnn(CCCC#N)c2)s1 |
| InChI | InChI=1S/C21H18N6S/c1-14-4-5-19(28-14)18-10-15-11-24-21-17(6-8-23-21)20(15)27(18)16-12-25-26(13-16)9-3-2-7-22/h4-6,8,10-13H,2-3,9H2,1H3,(H,23,24) |
| InChIKey | JZOIEFIDJQJNID-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 75.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|