C19H20N4O2S — CID 164621264
6-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]hexanoic acid (PubChem CID 164621264) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is 6-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]hexanoic acid.
| Compound Name | 6-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]hexanoic acid |
|---|---|
| PubChem CID | 164621264 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 6-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]hexanoic acid |
| SMILES | O=C(O)CCCCCSc1nnc(-c2ccncc2)n1-c1ccccc1 |
| InChI | InChI=1S/C19H20N4O2S/c24-17(25)9-5-2-6-14-26-19-22-21-18(15-10-12-20-13-11-15)23(19)16-7-3-1-4-8-16/h1,3-4,7-8,10-13H,2,5-6,9,14H2,(H,24,25) |
| InChIKey | ANRGNNSUQLCKLH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|