C20H14Cl2N4O3 — CID 164621319
5-[[1,3-bis(4-chlorophenyl)pyrazol-4-yl]methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 164621319) has the molecular formula C20H14Cl2N4O3 and a molecular weight of 429.26 g/mol. Its IUPAC name is 5-[[1,3-bis(4-chlorophenyl)pyrazol-4-yl]methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[1,3-bis(4-chlorophenyl)pyrazol-4-yl]methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 164621319 |
| Molecular Formula | C20H14Cl2N4O3 |
| Molecular Weight | 429.26 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | 5-[[1,3-bis(4-chlorophenyl)pyrazol-4-yl]methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(Cc2cn(-c3ccc(Cl)cc3)nc2-c2ccc(Cl)cc2)C(=O)N1 |
| InChI | InChI=1S/C20H14Cl2N4O3/c21-13-3-1-11(2-4-13)17-12(9-16-18(27)23-20(29)24-19(16)28)10-26(25-17)15-7-5-14(22)6-8-15/h1-8,10,16H,9H2,(H2,23,24,27,28,29) |
| InChIKey | HCQUZGJIDNDBCI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.26 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|