C25H31FN2O3 — CID 164621351
7-[3-[ethyl-[[2-(5-fluoro-2-methoxyphenyl)cyclopropyl]methyl]amino]propoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 164621351) has the molecular formula C25H31FN2O3 and a molecular weight of 426.53 g/mol. Its IUPAC name is 7-[3-[ethyl-[[2-(5-fluoro-2-methoxyphenyl)cyclopropyl]methyl]amino]propoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-[3-[ethyl-[[2-(5-fluoro-2-methoxyphenyl)cyclopropyl]methyl]amino]propoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 164621351 |
| Molecular Formula | C25H31FN2O3 |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 7-[3-[ethyl-[[2-(5-fluoro-2-methoxyphenyl)cyclopropyl]methyl]amino]propoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CCN(CCCOc1ccc2c(c1)NC(=O)CC2)CC1CC1c1cc(F)ccc1OC |
| InChI | InChI=1S/C25H31FN2O3/c1-3-28(16-18-13-21(18)22-14-19(26)7-9-24(22)30-2)11-4-12-31-20-8-5-17-6-10-25(29)27-23(17)15-20/h5,7-9,14-15,18,21H,3-4,6,10-13,16H2,1-2H3,(H,27,29) |
| InChIKey | OIXWMGVKJCJKNE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|