C26H33FN2O3 — CID 164621372
7-[4-[ethyl-[[2-(5-fluoro-2-methoxyphenyl)cyclopropyl]methyl]amino]butoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 164621372) has the molecular formula C26H33FN2O3 and a molecular weight of 440.56 g/mol. Its IUPAC name is 7-[4-[ethyl-[[2-(5-fluoro-2-methoxyphenyl)cyclopropyl]methyl]amino]butoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-[4-[ethyl-[[2-(5-fluoro-2-methoxyphenyl)cyclopropyl]methyl]amino]butoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 164621372 |
| Molecular Formula | C26H33FN2O3 |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | 7-[4-[ethyl-[[2-(5-fluoro-2-methoxyphenyl)cyclopropyl]methyl]amino]butoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CCN(CCCCOc1ccc2c(c1)NC(=O)CC2)CC1CC1c1cc(F)ccc1OC |
| InChI | InChI=1S/C26H33FN2O3/c1-3-29(17-19-14-22(19)23-15-20(27)8-10-25(23)31-2)12-4-5-13-32-21-9-6-18-7-11-26(30)28-24(18)16-21/h6,8-10,15-16,19,22H,3-5,7,11-14,17H2,1-2H3,(H,28,30) |
| InChIKey | XMDWXYNACAUCTC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|