About 2-(3-but-3-ynyldiazirin-3-yl)ethyl 2-[4-[(2,5-dichlorophenyl)sulfonyl-ethylamino]phenyl]acetate
2-(3-but-3-ynyldiazirin-3-yl)ethyl 2-[4-[(2,5-dichlorophenyl)sulfonyl-ethylamino]phenyl]acetate (PubChem CID 164621514) has the molecular formula C23H23Cl2N3O4S
and a molecular weight of 508.43 g/mol. Its IUPAC name is 2-(3-but-3-ynyldiazirin-3-yl)ethyl 2-[4-[(2,5-dichlorophenyl)sulfonyl-ethylamino]phenyl]acetate.
Molecular Properties
| Compound Name | 2-(3-but-3-ynyldiazirin-3-yl)ethyl 2-[4-[(2,5-dichlorophenyl)sulfonyl-ethylamino]phenyl]acetate |
| PubChem CID | 164621514 |
| Molecular Formula | C23H23Cl2N3O4S |
| Molecular Weight | 508.43 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | 2-(3-but-3-ynyldiazirin-3-yl)ethyl 2-[4-[(2,5-dichlorophenyl)sulfonyl-ethylamino]phenyl]acetate |
| SMILES | C#CCCC1(CCOC(=O)Cc2ccc(N(CC)S(=O)(=O)c3cc(Cl)ccc3Cl)cc2)N=N1 |
| InChI | InChI=1S/C23H23Cl2N3O4S/c1-3-5-12-23(26-27-23)13-14-32-22(29)15-17-6-9-19(10-7-17)28(4-2)33(30,31)21-16-18(24)8-11-20(21)25/h1,6-11,16H,4-5,12-15H2,2H3 |
| InChIKey | WDNCTZNBLRKBIJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.43 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-but-3-ynyldiazirin-3-yl)ethyl 2-[4-[(2,5-dichlorophenyl)sulfonyl-ethylamino]phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-but-3-ynyldiazirin-3-yl)ethyl 2-[4-[(2,5-dichlorophenyl)sulfonyl-ethylamino]phenyl]acetate?
The IUPAC name of 2-(3-but-3-ynyldiazirin-3-yl)ethyl 2-[4-[(2,5-dichlorophenyl)sulfonyl-ethylamino]phenyl]acetate (CID 164621514) is 2-(3-but-3-ynyldiazirin-3-yl)ethyl 2-[4-[(2,5-dichlorophenyl)sulfonyl-ethylamino]phenyl]acetate.
What is the SMILES notation for 2-(3-but-3-ynyldiazirin-3-yl)ethyl 2-[4-[(2,5-dichlorophenyl)sulfonyl-ethylamino]phenyl]acetate?
The canonical SMILES for 2-(3-but-3-ynyldiazirin-3-yl)ethyl 2-[4-[(2,5-dichlorophenyl)sulfonyl-ethylamino]phenyl]acetate is C#CCCC1(CCOC(=O)Cc2ccc(N(CC)S(=O)(=O)c3cc(Cl)ccc3Cl)cc2)N=N1.
What is the InChIKey of 2-(3-but-3-ynyldiazirin-3-yl)ethyl 2-[4-[(2,5-dichlorophenyl)sulfonyl-ethylamino]phenyl]acetate?
The InChIKey is WDNCTZNBLRKBIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23Cl2N3O4S/c1-3-5-12-23(26-27-23)13-14-32-22(29)15-17-6-9-19(10-7-17)28(4-2)33(30,31)21-16-18(24)8-11-20(21)25/h1,6-11,16H,4-5,12-15H2,2H3.
What are the key properties of 2-(3-but-3-ynyldiazirin-3-yl)ethyl 2-[4-[(2,5-dichlorophenyl)sulfonyl-ethylamino]phenyl]acetate?
2-(3-but-3-ynyldiazirin-3-yl)ethyl 2-[4-[(2,5-dichlorophenyl)sulfonyl-ethylamino]phenyl]acetate has a molecular weight of 508.43 g/mol, XLogP of 5.26, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-but-3-ynyldiazirin-3-yl)ethyl 2-[4-[(2,5-dichlorophenyl)sulfonyl-ethylamino]phenyl]acetate is sourced from PubChem (CID 164621514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).