About 4-benzylpyrrolo[1,2-a]quinoxaline
4-benzylpyrrolo[1,2-a]quinoxaline (PubChem CID 164621618) has the molecular formula C18H14N2
and a molecular weight of 258.32 g/mol. Its IUPAC name is 4-benzylpyrrolo[1,2-a]quinoxaline.
Molecular Properties
| Compound Name | 4-benzylpyrrolo[1,2-a]quinoxaline |
| PubChem CID | 164621618 |
| Molecular Formula | C18H14N2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 4-benzylpyrrolo[1,2-a]quinoxaline |
| SMILES | c1ccc(Cc2nc3ccccc3n3cccc23)cc1 |
| InChI | InChI=1S/C18H14N2/c1-2-7-14(8-3-1)13-16-18-11-6-12-20(18)17-10-5-4-9-15(17)19-16/h1-12H,13H2 |
| InChIKey | JITOGCCOHOTFLI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-benzylpyrrolo[1,2-a]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzylpyrrolo[1,2-a]quinoxaline?
The IUPAC name of 4-benzylpyrrolo[1,2-a]quinoxaline (CID 164621618) is 4-benzylpyrrolo[1,2-a]quinoxaline.
What is the SMILES notation for 4-benzylpyrrolo[1,2-a]quinoxaline?
The canonical SMILES for 4-benzylpyrrolo[1,2-a]quinoxaline is c1ccc(Cc2nc3ccccc3n3cccc23)cc1.
What is the InChIKey of 4-benzylpyrrolo[1,2-a]quinoxaline?
The InChIKey is JITOGCCOHOTFLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2/c1-2-7-14(8-3-1)13-16-18-11-6-12-20(18)17-10-5-4-9-15(17)19-16/h1-12H,13H2.
What are the key properties of 4-benzylpyrrolo[1,2-a]quinoxaline?
4-benzylpyrrolo[1,2-a]quinoxaline has a molecular weight of 258.32 g/mol, XLogP of 4.08, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzylpyrrolo[1,2-a]quinoxaline is sourced from PubChem (CID 164621618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).