C29H33N3O3S — CID 164621699
2-(1-adamantyl)-N-[4-(7-imino-4,6-dioxo-2-phenylthieno[3,2-c]pyridin-5-yl)butyl]acetamide (PubChem CID 164621699) has the molecular formula C29H33N3O3S and a molecular weight of 503.67 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[4-(7-imino-4,6-dioxo-2-phenylthieno[3,2-c]pyridin-5-yl)butyl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[4-(7-imino-4,6-dioxo-2-phenylthieno[3,2-c]pyridin-5-yl)butyl]acetamide |
|---|---|
| PubChem CID | 164621699 |
| Molecular Formula | C29H33N3O3S |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 2-(1-adamantyl)-N-[4-(7-imino-4,6-dioxo-2-phenylthieno[3,2-c]pyridin-5-yl)butyl]acetamide |
| SMILES | [H]/N=C1/C(=O)N(CCCCNC(=O)CC23CC4CC(CC(C4)C2)C3)C(=O)c2cc(-c3ccccc3)sc21 |
| InChI | InChI=1S/C29H33N3O3S/c30-25-26-22(13-23(36-26)21-6-2-1-3-7-21)27(34)32(28(25)35)9-5-4-8-31-24(33)17-29-14-18-10-19(15-29)12-20(11-18)16-29/h1-3,6-7,13,18-20,30H,4-5,8-12,14-17H2,(H,31,33)/b30-25+ |
| InChIKey | UPQGVVMSPGPEKY-QCWLDUFUSA-N |
| XLogP | 5.27 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|