C26H36O4 — CID 164621714
(2E,5E,9E)-2-[(E)-3-[(2R)-2-methoxy-5-oxo-2H-furan-3-yl]prop-2-enylidene]-6,10,14-trimethylpentadeca-5,9,13-trienal (PubChem CID 164621714) has the molecular formula C26H36O4 and a molecular weight of 412.57 g/mol. Its IUPAC name is (2E,5E,9E)-2-[(E)-3-[(2R)-2-methoxy-5-oxo-2H-furan-3-yl]prop-2-enylidene]-6,10,14-trimethylpentadeca-5,9,13-trienal.
| Compound Name | (2E,5E,9E)-2-[(E)-3-[(2R)-2-methoxy-5-oxo-2H-furan-3-yl]prop-2-enylidene]-6,10,14-trimethylpentadeca-5,9,13-trienal |
|---|---|
| PubChem CID | 164621714 |
| Molecular Formula | C26H36O4 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | (2E,5E,9E)-2-[(E)-3-[(2R)-2-methoxy-5-oxo-2H-furan-3-yl]prop-2-enylidene]-6,10,14-trimethylpentadeca-5,9,13-trienal |
| SMILES | CO[C@@H]1OC(=O)C=C1/C=C/C=C(/C=O)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C26H36O4/c1-20(2)10-6-11-21(3)12-7-13-22(4)14-8-15-23(19-27)16-9-17-24-18-25(28)30-26(24)29-5/h9-10,12,14,16-19,26H,6-8,11,13,15H2,1-5H3/b17-9+,21-12+,22-14+,23-16+/t26-/m1/s1 |
| InChIKey | FRJKONVBPCHARW-VDOLXLQQSA-N |
| XLogP | 6.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|