C31H28BrN3S — CID 164621767
8-benzyl-4-tert-butyl-6-phenyl-12-thiophen-2-yl-1,5-diaza-8-azoniatricyclo[7.4.0.02,7]trideca-2,4,6,8,10,12-hexaene bromide (PubChem CID 164621767) has the molecular formula C31H28BrN3S and a molecular weight of 554.56 g/mol. Its IUPAC name is 8-benzyl-4-tert-butyl-6-phenyl-12-thiophen-2-yl-1,5-diaza-8-azoniatricyclo[7.4.0.02,7]trideca-2,4,6,8,10,12-hexaene bromide.
| Compound Name | 8-benzyl-4-tert-butyl-6-phenyl-12-thiophen-2-yl-1,5-diaza-8-azoniatricyclo[7.4.0.02,7]trideca-2,4,6,8,10,12-hexaene bromide |
|---|---|
| PubChem CID | 164621767 |
| Molecular Formula | C31H28BrN3S |
| Molecular Weight | 554.56 g/mol |
| Exact Mass | 553.12 |
| IUPAC Name | 8-benzyl-4-tert-butyl-6-phenyl-12-thiophen-2-yl-1,5-diaza-8-azoniatricyclo[7.4.0.02,7]trideca-2,4,6,8,10,12-hexaene bromide |
| SMILES | CC(C)(C)c1cc2c(c(-c3ccccc3)n1)[n+](Cc1ccccc1)c1ccc(-c3cccs3)cn21.[Br-] |
| InChI | InChI=1S/C31H28N3S.BrH/c1-31(2,3)27-19-25-30(29(32-27)23-13-8-5-9-14-23)34(20-22-11-6-4-7-12-22)28-17-16-24(21-33(25)28)26-15-10-18-35-26;/h4-19,21H,20H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | HJCSSXHMXUNWIX-UHFFFAOYSA-M |
| XLogP | 4.52 |
| TPSA | 21.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|