C23H21N7O2S2 — CID 164621906
2-[1-ethylsulfonyl-3-[4-(4-thiophen-2-yl-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)pyrazol-1-yl]azetidin-3-yl]acetonitrile (PubChem CID 164621906) has the molecular formula C23H21N7O2S2 and a molecular weight of 491.60 g/mol. Its IUPAC name is 2-[1-ethylsulfonyl-3-[4-(4-thiophen-2-yl-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)pyrazol-1-yl]azetidin-3-yl]acetonitrile.
| Compound Name | 2-[1-ethylsulfonyl-3-[4-(4-thiophen-2-yl-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)pyrazol-1-yl]azetidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 164621906 |
| Molecular Formula | C23H21N7O2S2 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 2-[1-ethylsulfonyl-3-[4-(4-thiophen-2-yl-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)pyrazol-1-yl]azetidin-3-yl]acetonitrile |
| SMILES | CCS(=O)(=O)N1CC(CC#N)(n2cc(-n3c(-c4cccs4)cc4cnc5[nH]ccc5c43)cn2)C1 |
| InChI | InChI=1S/C23H21N7O2S2/c1-2-34(31,32)28-14-23(15-28,6-7-24)29-13-17(12-27-29)30-19(20-4-3-9-33-20)10-16-11-26-22-18(21(16)30)5-8-25-22/h3-5,8-13H,2,6,14-15H2,1H3,(H,25,26) |
| InChIKey | QOPCTDIJTCSBPX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 112.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |